a-terpinyl acetate


acetic acid terpinyl ester; 1-methyl-1-(4-methylcyclohex-3-en-1-yl)ethyl acetate; terpinyl acetate; (±)-α-terpinyl acetate; α-terpinyl acetate
CAS RN:[80-26-2]
Formula:C12H20O2; 196.29 g/mol
InChiKey:IGODOXYLBBXFDW-UHFFFAOYSA-N
SMILES:CC1=CCC(CC1)C(C)(C)OC(=O)C
Molecular structure of a-terpinyl acetate
Use:perfumes; shading almond, apricot, cherry, greengage, gooseberry, and mirabelle-plum flavors and essences
Retetion Index:1 346 (HP5MS)
Density:0.953 g/mL
Molar volume:206.0 mL/mol
Refractive index:1.465
Molecular refractive power:56.89 mL/mol
Boiling point:220 °C
Log10 partition octanol / water:3.96

Isomers

allyl cyclohexanepropionate
Molecular structure of allyl cyclohexanepropionate
1,4-bis[(E)-prop-1-enoxy]cyclohexane
Molecular structure of 1,4-bis[(E)-prop-1-enoxy]cyclohexane
bornyl acetate
Molecular structure of bornyl acetate
λ-bornyl acetate
Molecular structure of l-bornyl acetate
d-bornyl acetate
Molecular structure of d-bornyl acetate
3-butyl-3α,4,5,6,7,7α-hexahydro-3H-2-benzofuran-1-one
Molecular structure of 3-butyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one
1,2-cyclododecanedione
Molecular structure of 1,2-cyclododecanedione
cis-3,7-dimethyl-2,6-octadien-1-yl acetate
Molecular structure of cis-3,7-dimethyl-2,6-octadien-1-yl acetate
dodecynoic acid
Molecular structure of dodecynoic acid
ethyl chrysanthemate
Molecular structure of ethyl chrysanthemate
ethyl 2-trans-4-cis-decadienoate
Molecular structure of ethyl 2-trans-4-cis-decadienoate
ethyl 3,5-dimethylcyclohex-1-eneacetate
Molecular structure of ethyl 3,5-dimethylcyclohex-1-eneacetate
ethyl 3,5-dimethylcyclohexylideneacetate
Molecular structure of ethyl 3,5-dimethylcyclohexylideneacetate
(1R)-(+)-fenchyl acetate
Molecular structure of (1R)-(+)-fenchyl acetate
geranyl acetate
Molecular structure of geranyl acetate
(E)-hex-3-en-1-yl (E)-hex-3-enoate
Molecular structure of (E)-hex-3-en-1-yl (E)-hex-3-enoate
lavandulyl acetate
Molecular structure of lavandulyl acetate
linalyl acetate
Molecular structure of linalyl acetate
2-methyl-6-methylideneoct-7-en-2-yl acetate
Molecular structure of 2-methyl-6-methylideneoct-7-en-2-yl acetate
methyl 10-undecynoate
Molecular structure of methyl 10-undecynoate
neryl acetate
Molecular structure of neryl acetate
α-terpinyl acetate
Molecular structure of a-terpinyl acetate
2,2,4,4-tetraethyl-1,3-dioxocyclobutane
Molecular structure of 2,2,4,4-tetraethyl-1,3-dioxocyclobutane
[(1S,2S,4S)-1,7,7-trimethylnorbornan-2-yl] acetate
Molecular structure of [(1S,2S,4S)-1,7,7-trimethylnorbornan-2-yl] acetate